C26H26BrIN2O3 — CID 99944891
N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 99944891) has the molecular formula C26H26BrIN2O3 and a molecular weight of 621.31 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 99944891 |
| Molecular Formula | C26H26BrIN2O3 |
| Molecular Weight | 621.31 g/mol |
| Exact Mass | 620.02 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc(C)cc2C)cc(Br)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C26H26BrIN2O3/c1-4-32-24-13-20(12-23(27)26(24)33-16-19-6-9-22(28)10-7-19)15-29-30-25(31)14-21-8-5-17(2)11-18(21)3/h5-13,15H,4,14,16H2,1-3H3,(H,30,31)/b29-15- |
| InChIKey | WYEFJKWQOSCIAR-FDVSRXAVSA-N |
| XLogP | 6.34 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|