C28H30BrN3O4 — CID 5227319
N'-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dimethylphenyl)propanediamide (PubChem CID 5227319) has the molecular formula C28H30BrN3O4 and a molecular weight of 552.47 g/mol. Its IUPAC name is N'-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dimethylphenyl)propanediamide.
| Compound Name | N'-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dimethylphenyl)propanediamide |
|---|---|
| PubChem CID | 5227319 |
| Molecular Formula | C28H30BrN3O4 |
| Molecular Weight | 552.47 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | N'-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(3,4-dimethylphenyl)propanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2ccc(C)c(C)c2)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H30BrN3O4/c1-5-35-25-14-22(13-24(29)28(25)36-17-21-9-6-18(2)7-10-21)16-30-32-27(34)15-26(33)31-23-11-8-19(3)20(4)12-23/h6-14,16H,5,15,17H2,1-4H3,(H,31,33)(H,32,34) |
| InChIKey | ACQSHLHZNIJIGP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|