C20H22BrN3O4 — CID 5174740
N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)propanediamide (PubChem CID 5174740) has the molecular formula C20H22BrN3O4 and a molecular weight of 448.32 g/mol. Its IUPAC name is N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)propanediamide.
| Compound Name | N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)propanediamide |
|---|---|
| PubChem CID | 5174740 |
| Molecular Formula | C20H22BrN3O4 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)propanediamide |
| SMILES | COc1cc(C=NNC(=O)CC(=O)Nc2ccc(C)c(C)c2)cc(Br)c1OC |
| InChI | InChI=1S/C20H22BrN3O4/c1-12-5-6-15(7-13(12)2)23-18(25)10-19(26)24-22-11-14-8-16(21)20(28-4)17(9-14)27-3/h5-9,11H,10H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | WCOFZGXJWHBNKD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|