C21H24BrN3O5 — CID 4540205
N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)butanediamide (PubChem CID 4540205) has the molecular formula C21H24BrN3O5 and a molecular weight of 478.34 g/mol. Its IUPAC name is N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)butanediamide.
| Compound Name | N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 4540205 |
| Molecular Formula | C21H24BrN3O5 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | N'-[(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)butanediamide |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)NN=Cc2cc(Br)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H24BrN3O5/c1-4-30-16-7-5-15(6-8-16)24-19(26)9-10-20(27)25-23-13-14-11-17(22)21(29-3)18(12-14)28-2/h5-8,11-13H,4,9-10H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | MMMHVHGYJBGQCA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|