C18H17Br2N3O4 — CID 4011727
N'-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide (PubChem CID 4011727) has the molecular formula C18H17Br2N3O4 and a molecular weight of 499.16 g/mol. Its IUPAC name is N'-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide.
| Compound Name | N'-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 4011727 |
| Molecular Formula | C18H17Br2N3O4 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 496.96 |
| IUPAC Name | N'-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
| SMILES | CCOc1ccc(NC(=O)CC(=O)NN=Cc2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H17Br2N3O4/c1-2-27-13-5-3-12(4-6-13)22-16(24)9-17(25)23-21-10-11-7-14(19)18(26)15(20)8-11/h3-8,10,26H,2,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | XHXKOGQLKQEXNL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|