C21H22BrN3O4 — CID 3495978
N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide (PubChem CID 3495978) has the molecular formula C21H22BrN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide.
| Compound Name | N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 3495978 |
| Molecular Formula | C21H22BrN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | N'-[(3-bromo-4-prop-2-enoxyphenyl)methylideneamino]-N-(4-ethoxyphenyl)propanediamide |
| SMILES | C=CCOc1ccc(C=NNC(=O)CC(=O)Nc2ccc(OCC)cc2)cc1Br |
| InChI | InChI=1S/C21H22BrN3O4/c1-3-11-29-19-10-5-15(12-18(19)22)14-23-25-21(27)13-20(26)24-16-6-8-17(9-7-16)28-4-2/h3,5-10,12,14H,1,4,11,13H2,2H3,(H,24,26)(H,25,27) |
| InChIKey | SIABNRBXNCIFKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|