C20H20BrN3O5 — CID 3558466
methyl 2-[2-bromo-4-[[[3-(4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3558466) has the molecular formula C20H20BrN3O5 and a molecular weight of 462.30 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[[[3-(4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[[[3-(4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3558466 |
| Molecular Formula | C20H20BrN3O5 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | methyl 2-[2-bromo-4-[[[3-(4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)CC(=O)Nc2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C20H20BrN3O5/c1-13-3-6-15(7-4-13)23-18(25)10-19(26)24-22-11-14-5-8-17(16(21)9-14)29-12-20(27)28-2/h3-9,11H,10,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ORGMJLODZKANFA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|