C22H25N3O6 — CID 3357338
methyl 2-[4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 3357338) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is methyl 2-[4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3357338 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | methyl 2-[4-[[[3-(2,4-dimethylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)CC(=O)Nc2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C22H25N3O6/c1-14-5-7-17(15(2)9-14)24-20(26)11-21(27)25-23-12-16-6-8-18(19(10-16)29-3)31-13-22(28)30-4/h5-10,12H,11,13H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | HYGRXRXCDZNQRW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|