C20H20BrN3O6 — CID 5196442
methyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 5196442) has the molecular formula C20H20BrN3O6 and a molecular weight of 478.30 g/mol. Its IUPAC name is methyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 5196442 |
| Molecular Formula | C20H20BrN3O6 |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | methyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)CC(=O)Nc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C20H20BrN3O6/c1-28-17-9-13(7-8-16(17)30-12-20(27)29-2)11-22-24-19(26)10-18(25)23-15-6-4-3-5-14(15)21/h3-9,11H,10,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | XIDFIMVUTRVJCM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|