C21H22BrN3O6 — CID 3990528
ethyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 3990528) has the molecular formula C21H22BrN3O6 and a molecular weight of 492.33 g/mol. Its IUPAC name is ethyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3990528 |
| Molecular Formula | C21H22BrN3O6 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | ethyl 2-[4-[[[3-(2-bromoanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)CC(=O)Nc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C21H22BrN3O6/c1-3-30-21(28)13-31-17-9-8-14(10-18(17)29-2)12-23-25-20(27)11-19(26)24-16-7-5-4-6-15(16)22/h4-10,12H,3,11,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | UGAFFINBFMTUMR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|