C29H29BrN4O7 — CID 4693234
ethyl 4-[[2-[4-[[[3-(2-bromoanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetyl]amino]benzoate (PubChem CID 4693234) has the molecular formula C29H29BrN4O7 and a molecular weight of 625.48 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[[[3-(2-bromoanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[[[3-(2-bromoanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4693234 |
| Molecular Formula | C29H29BrN4O7 |
| Molecular Weight | 625.48 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | ethyl 4-[[2-[4-[[[3-(2-bromoanilino)-2-methyl-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(C=NNC(=O)C(C)C(=O)Nc3ccccc3Br)cc2OC)cc1 |
| InChI | InChI=1S/C29H29BrN4O7/c1-4-40-29(38)20-10-12-21(13-11-20)32-26(35)17-41-24-14-9-19(15-25(24)39-3)16-31-34-28(37)18(2)27(36)33-23-8-6-5-7-22(23)30/h5-16,18H,4,17H2,1-3H3,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | PCZMMLLUVHSDND-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|