C27H27FN4O6 — CID 4687352
N-[[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide (PubChem CID 4687352) has the molecular formula C27H27FN4O6 and a molecular weight of 522.53 g/mol. Its IUPAC name is N-[[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide.
| Compound Name | N-[[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 4687352 |
| Molecular Formula | C27H27FN4O6 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[[4-[2-(2-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-N'-(4-methoxyphenyl)-2-methylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C)C(=O)NN=Cc2ccc(OCC(=O)Nc3ccccc3F)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H27FN4O6/c1-17(26(34)30-19-9-11-20(36-2)12-10-19)27(35)32-29-15-18-8-13-23(24(14-18)37-3)38-16-25(33)31-22-7-5-4-6-21(22)28/h4-15,17H,16H2,1-3H3,(H,30,34)(H,31,33)(H,32,35) |
| InChIKey | TULQOEKBBWJTGB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|