C29H31FN4O6 — CID 3430151
N-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide (PubChem CID 3430151) has the molecular formula C29H31FN4O6 and a molecular weight of 550.59 g/mol. Its IUPAC name is N-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide.
| Compound Name | N-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 3430151 |
| Molecular Formula | C29H31FN4O6 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[[3-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
| SMILES | CCOc1cc(C=NNC(=O)C(C)NC(=O)Cc2ccc(OC)cc2)ccc1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C29H31FN4O6/c1-4-39-26-15-21(11-14-25(26)40-18-28(36)33-24-8-6-5-7-23(24)30)17-31-34-29(37)19(2)32-27(35)16-20-9-12-22(38-3)13-10-20/h5-15,17,19H,4,16,18H2,1-3H3,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | KEERNYSEPPZEOZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|