C27H28FN3O5 — CID 41009890
(2R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(2-phenoxyacetyl)amino]propanamide (PubChem CID 41009890) has the molecular formula C27H28FN3O5 and a molecular weight of 493.54 g/mol. Its IUPAC name is (2R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(2-phenoxyacetyl)amino]propanamide.
| Compound Name | (2R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(2-phenoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 41009890 |
| Molecular Formula | C27H28FN3O5 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (2R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(2-phenoxyacetyl)amino]propanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](C)NC(=O)COc2ccccc2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN3O5/c1-3-34-25-15-21(11-14-24(25)36-17-20-9-12-22(28)13-10-20)16-29-31-27(33)19(2)30-26(32)18-35-23-7-5-4-6-8-23/h4-16,19H,3,17-18H2,1-2H3,(H,30,32)(H,31,33)/b29-16-/t19-/m1/s1 |
| InChIKey | YSXKIVRXXLCPNL-FHLIKIBJSA-N |
| XLogP | 3.84 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|