C28H31FN2O5 — CID 96873720
(4R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide (PubChem CID 96873720) has the molecular formula C28H31FN2O5 and a molecular weight of 494.56 g/mol. Its IUPAC name is (4R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide.
| Compound Name | (4R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 96873720 |
| Molecular Formula | C28H31FN2O5 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (4R)-N-[(Z)-[3-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
| SMILES | CCOc1ccc([C@H](O)CCC(=O)N/N=C\c2ccc(OCc3ccc(F)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C28H31FN2O5/c1-3-34-24-12-8-22(9-13-24)25(32)14-16-28(33)31-30-18-21-7-15-26(27(17-21)35-4-2)36-19-20-5-10-23(29)11-6-20/h5-13,15,17-18,25,32H,3-4,14,16,19H2,1-2H3,(H,31,33)/b30-18-/t25-/m1/s1 |
| InChIKey | LRAGGMLWAOTKFX-TZMKENEKSA-N |
| XLogP | 5.17 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|