C26H26Cl2N2O4 — CID 96874073
(4R)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide (PubChem CID 96874073) has the molecular formula C26H26Cl2N2O4 and a molecular weight of 501.41 g/mol. Its IUPAC name is (4R)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide.
| Compound Name | (4R)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 96874073 |
| Molecular Formula | C26H26Cl2N2O4 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (4R)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
| SMILES | CCOc1ccc([C@H](O)CCC(=O)N/N=C\c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C26H26Cl2N2O4/c1-2-33-21-10-6-20(7-11-21)25(31)13-14-26(32)30-29-16-18-3-8-22(9-4-18)34-17-19-5-12-23(27)24(28)15-19/h3-12,15-16,25,31H,2,13-14,17H2,1H3,(H,30,32)/b29-16-/t25-/m1/s1 |
| InChIKey | ISWKQVMKOICSJJ-XMJXUFPISA-N |
| XLogP | 5.93 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|