C23H21Cl2N3O6 — CID 96873890
(4S)-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide (PubChem CID 96873890) has the molecular formula C23H21Cl2N3O6 and a molecular weight of 506.34 g/mol. Its IUPAC name is (4S)-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide.
| Compound Name | (4S)-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 96873890 |
| Molecular Formula | C23H21Cl2N3O6 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | (4S)-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]-4-(4-ethoxyphenyl)-4-hydroxybutanamide |
| SMILES | CCOc1ccc([C@@H](O)CCC(=O)N/N=C\c2ccc(-c3cc([N+](=O)[O-])c(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O6/c1-2-33-15-5-3-14(4-6-15)21(29)8-10-23(30)27-26-13-16-7-9-22(34-16)17-11-20(28(31)32)19(25)12-18(17)24/h3-7,9,11-13,21,29H,2,8,10H2,1H3,(H,27,30)/b26-13-/t21-/m0/s1 |
| InChIKey | KNTVJAVIWSTXHT-VHLXNKDGSA-N |
| XLogP | 5.52 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|