C19H12Cl3N3O4S — CID 126218733
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126218733) has the molecular formula C19H12Cl3N3O4S and a molecular weight of 484.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126218733 |
| Molecular Formula | C19H12Cl3N3O4S |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)N/N=C\c1ccc(-c2cc([N+](=O)[O-])c(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C19H12Cl3N3O4S/c20-11-1-4-13(5-2-11)30-10-19(26)24-23-9-12-3-6-18(29-12)14-7-17(25(27)28)16(22)8-15(14)21/h1-9H,10H2,(H,24,26)/b23-9- |
| InChIKey | QNWFMFLRMKDHDF-AQHIEDMUSA-N |
| XLogP | 6.06 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|