C16H15ClN4O5 — CID 9351695
N'-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 9351695) has the molecular formula C16H15ClN4O5 and a molecular weight of 378.77 g/mol. Its IUPAC name is N'-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 9351695 |
| Molecular Formula | C16H15ClN4O5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N'-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)N/N=C\c1ccc(-c2ccc(Cl)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H15ClN4O5/c1-9(2)19-15(22)16(23)20-18-8-11-4-6-14(26-11)12-5-3-10(17)7-13(12)21(24)25/h3-9H,1-2H3,(H,19,22)(H,20,23)/b18-8- |
| InChIKey | ILMUPVUZGKNRJT-LSCVHKIXSA-N |
| XLogP | 2.48 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|