C14H7ClF7N3O3 — CID 126045435
N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126045435) has the molecular formula C14H7ClF7N3O3 and a molecular weight of 433.67 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126045435 |
| Molecular Formula | C14H7ClF7N3O3 |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1-c1ccc(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)o1 |
| InChI | InChI=1S/C14H7ClF7N3O3/c15-7-1-3-9(10(5-7)25(26)27)11-4-2-8(28-11)6-23-24-14(21,22)12(16,17)13(18,19)20/h1-6,24H/b23-6- |
| InChIKey | GDLKEEAHDGOTEF-OUBWWKSTSA-N |
| XLogP | 5.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|