C18H12ClN3O5 — CID 9073127
N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-hydroxybenzamide (PubChem CID 9073127) has the molecular formula C18H12ClN3O5 and a molecular weight of 385.76 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 9073127 |
| Molecular Formula | C18H12ClN3O5 |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(Cl)cc2[N+](=O)[O-])o1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H12ClN3O5/c19-12-3-7-15(16(9-12)22(25)26)17-8-6-14(27-17)10-20-21-18(24)11-1-4-13(23)5-2-11/h1-10,23H,(H,21,24)/b20-10- |
| InChIKey | XUVGKPFNATZVQS-JMIUGGIZSA-N |
| XLogP | 3.98 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|