C20H10Br2ClN3O5 — CID 21376057
5,7-dibromo-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376057) has the molecular formula C20H10Br2ClN3O5 and a molecular weight of 567.58 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376057 |
| Molecular Formula | C20H10Br2ClN3O5 |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 564.87 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(Cl)cc2[N+](=O)[O-])o1)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C20H10Br2ClN3O5/c21-11-5-10-6-18(31-19(10)15(22)7-11)20(27)25-24-9-13-2-4-17(30-13)14-3-1-12(23)8-16(14)26(28)29/h1-9H,(H,25,27)/b24-9- |
| InChIKey | BCLDGJSSCSDYMW-OPVMPGTRSA-N |
| XLogP | 6.54 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|