C22H14Br2N2O4 — CID 21376056
N-[(Z)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide (PubChem CID 21376056) has the molecular formula C22H14Br2N2O4 and a molecular weight of 530.17 g/mol. Its IUPAC name is N-[(Z)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376056 |
| Molecular Formula | C22H14Br2N2O4 |
| Molecular Weight | 530.17 g/mol |
| Exact Mass | 527.93 |
| IUPAC Name | N-[(Z)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)c1ccc(-c2ccc(/C=N\NC(=O)c3cc4cc(Br)cc(Br)c4o3)o2)cc1 |
| InChI | InChI=1S/C22H14Br2N2O4/c1-12(27)13-2-4-14(5-3-13)19-7-6-17(29-19)11-25-26-22(28)20-9-15-8-16(23)10-18(24)21(15)30-20/h2-11H,1H3,(H,26,28)/b25-11- |
| InChIKey | AMNWKTHSLYNDQT-GATIEOLUSA-N |
| XLogP | 6.18 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.17 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|