C24H14Br2N2O2 — CID 21375519
N-[(Z)-anthracen-9-ylmethylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide (PubChem CID 21375519) has the molecular formula C24H14Br2N2O2 and a molecular weight of 522.20 g/mol. Its IUPAC name is N-[(Z)-anthracen-9-ylmethylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-anthracen-9-ylmethylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375519 |
| Molecular Formula | C24H14Br2N2O2 |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 519.94 |
| IUPAC Name | N-[(Z)-anthracen-9-ylmethylideneamino]-5,7-dibromo-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1c2ccccc2cc2ccccc12)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C24H14Br2N2O2/c25-17-10-16-11-22(30-23(16)21(26)12-17)24(29)28-27-13-20-18-7-3-1-5-14(18)9-15-6-2-4-8-19(15)20/h1-13H,(H,28,29)/b27-13- |
| InChIKey | KGPYWFAHWLMXKH-WKIKZPBSSA-N |
| XLogP | 7.03 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|