C19H13Br2N3O2 — CID 135563355
5,7-dibromo-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 135563355) has the molecular formula C19H13Br2N3O2 and a molecular weight of 475.14 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 135563355 |
| Molecular Formula | C19H13Br2N3O2 |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 472.94 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C19H13Br2N3O2/c1-10-14(13-4-2-3-5-16(13)23-10)9-22-24-19(25)17-7-11-6-12(20)8-15(21)18(11)26-17/h2-9,23H,1H3,(H,24,25)/b22-9- |
| InChIKey | NMNDLHACTJDQRF-AFPJDJCSSA-N |
| XLogP | 5.51 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|