C28H18Br2N2O5 — CID 21376297
4-[[1-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid (PubChem CID 21376297) has the molecular formula C28H18Br2N2O5 and a molecular weight of 622.27 g/mol. Its IUPAC name is 4-[[1-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[1-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 21376297 |
| Molecular Formula | C28H18Br2N2O5 |
| Molecular Weight | 622.27 g/mol |
| Exact Mass | 619.96 |
| IUPAC Name | 4-[[1-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc3ccccc3c2/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc1 |
| InChI | InChI=1S/C28H18Br2N2O5/c29-20-11-19-12-25(37-26(19)23(30)13-20)27(33)32-31-14-22-21-4-2-1-3-17(21)9-10-24(22)36-15-16-5-7-18(8-6-16)28(34)35/h1-14H,15H2,(H,32,33)(H,34,35)/b31-14- |
| InChIKey | OYUVABCRJIZWQW-AQLQTECXSA-N |
| XLogP | 7.15 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.27 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|