C28H17Br2N3O3 — CID 21376301
5,7-dibromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376301) has the molecular formula C28H17Br2N3O3 and a molecular weight of 603.27 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376301 |
| Molecular Formula | C28H17Br2N3O3 |
| Molecular Weight | 603.27 g/mol |
| Exact Mass | 600.96 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | N#Cc1ccccc1COc1ccc2ccccc2c1/C=N\NC(=O)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C28H17Br2N3O3/c29-21-11-20-12-26(36-27(20)24(30)13-21)28(34)33-32-15-23-22-8-4-3-5-17(22)9-10-25(23)35-16-19-7-2-1-6-18(19)14-31/h1-13,15H,16H2,(H,33,34)/b32-15- |
| InChIKey | LVIVTVBRKFZFMH-CNCDYAKUSA-N |
| XLogP | 7.33 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.27 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|