C27H21N3O2 — CID 19061178
N-[(E)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-methylbenzamide (PubChem CID 19061178) has the molecular formula C27H21N3O2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[(E)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(E)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 19061178 |
| Molecular Formula | C27H21N3O2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[(E)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/N=C/c1c(OCc2ccccc2C#N)ccc2ccccc12 |
| InChI | InChI=1S/C27H21N3O2/c1-19-8-2-6-12-23(19)27(31)30-29-17-25-24-13-7-5-9-20(24)14-15-26(25)32-18-22-11-4-3-10-21(22)16-28/h2-15,17H,18H2,1H3,(H,30,31)/b29-17+ |
| InChIKey | JKSIQQZVGVZCES-STBIYBPSSA-N |
| XLogP | 5.36 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|