C27H20ClN3O2S — CID 126223223
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide (PubChem CID 126223223) has the molecular formula C27H20ClN3O2S and a molecular weight of 486.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126223223 |
| Molecular Formula | C27H20ClN3O2S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
| SMILES | N#Cc1ccccc1COc1ccc2ccccc2c1/C=N\NC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClN3O2S/c28-22-10-12-23(13-11-22)34-18-27(32)31-30-16-25-24-8-4-3-5-19(24)9-14-26(25)33-17-21-7-2-1-6-20(21)15-29/h1-14,16H,17-18H2,(H,31,32)/b30-16- |
| InChIKey | NGJNQWREYDSOCB-UHBFCERESA-N |
| XLogP | 6.19 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|