C26H21BrClN3O2 — CID 126355675
2-(4-bromoanilino)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide (PubChem CID 126355675) has the molecular formula C26H21BrClN3O2 and a molecular weight of 522.83 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126355675 |
| Molecular Formula | C26H21BrClN3O2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(Z)-[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(Br)cc1)N/N=C\c1c(OCc2ccc(Cl)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C26H21BrClN3O2/c27-20-8-12-22(13-9-20)29-16-26(32)31-30-15-24-23-4-2-1-3-19(23)7-14-25(24)33-17-18-5-10-21(28)11-6-18/h1-15,29H,16-17H2,(H,31,32)/b30-15- |
| InChIKey | RWBWCSJNFLTVKR-MNDYBZJGSA-N |
| XLogP | 6.40 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|