C30H23BrN2O2 — CID 19061642
2-(4-bromophenyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)naphthalen-1-yl]methylideneamino]acetamide (PubChem CID 19061642) has the molecular formula C30H23BrN2O2 and a molecular weight of 523.43 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)naphthalen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)naphthalen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19061642 |
| Molecular Formula | C30H23BrN2O2 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(E)-[2-(naphthalen-1-ylmethoxy)naphthalen-1-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)N/N=C/c1c(OCc2cccc3ccccc23)ccc2ccccc12 |
| InChI | InChI=1S/C30H23BrN2O2/c31-25-15-12-21(13-16-25)18-30(34)33-32-19-28-27-11-4-2-7-23(27)14-17-29(28)35-20-24-9-5-8-22-6-1-3-10-26(22)24/h1-17,19H,18,20H2,(H,33,34)/b32-19+ |
| InChIKey | TXDYSYMJELNLMF-BIZUNTBRSA-N |
| XLogP | 7.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|