C29H26BrN3O3 — CID 3373679
N'-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide (PubChem CID 3373679) has the molecular formula C29H26BrN3O3 and a molecular weight of 544.45 g/mol. Its IUPAC name is N'-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide.
| Compound Name | N'-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide |
|---|---|
| PubChem CID | 3373679 |
| Molecular Formula | C29H26BrN3O3 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N'-[[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-N-(2,4-dimethylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)NN=Cc2c(OCc3ccc(Br)cc3)ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C29H26BrN3O3/c1-19-7-13-26(20(2)15-19)32-28(34)16-29(35)33-31-17-25-24-6-4-3-5-22(24)10-14-27(25)36-18-21-8-11-23(30)12-9-21/h3-15,17H,16,18H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | KMSFLPLTWXXWPU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|