C23H14Br2ClIN2O3 — CID 21375828
5,7-dibromo-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375828) has the molecular formula C23H14Br2ClIN2O3 and a molecular weight of 688.54 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375828 |
| Molecular Formula | C23H14Br2ClIN2O3 |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 685.81 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccccc2Cl)c(I)c1)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C23H14Br2ClIN2O3/c24-16-8-15-9-21(32-22(15)17(25)10-16)23(30)29-28-11-13-5-6-20(19(27)7-13)31-12-14-3-1-2-4-18(14)26/h1-11H,12H2,(H,29,30)/b28-11- |
| InChIKey | IVPHHNHRPVSRMZ-FXMZOFOKSA-N |
| XLogP | 7.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|