C18H13Br3N2O3 — CID 21376210
5,7-dibromo-N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376210) has the molecular formula C18H13Br3N2O3 and a molecular weight of 545.03 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376210 |
| Molecular Formula | C18H13Br3N2O3 |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 541.85 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc(Br)cc1/C=N\NC(=O)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C18H13Br3N2O3/c1-2-25-15-4-3-12(19)6-11(15)9-22-23-18(24)16-7-10-5-13(20)8-14(21)17(10)26-16/h3-9H,2H2,1H3,(H,23,24)/b22-9- |
| InChIKey | YHXHQTLDZQMVEL-AFPJDJCSSA-N |
| XLogP | 5.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|