C18H10Br2IN3O3 — CID 126022755
5-bromo-N-[(Z)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126022755) has the molecular formula C18H10Br2IN3O3 and a molecular weight of 603.01 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126022755 |
| Molecular Formula | C18H10Br2IN3O3 |
| Molecular Weight | 603.01 g/mol |
| Exact Mass | 600.81 |
| IUPAC Name | 5-bromo-N-[(Z)-[5-bromo-2-(cyanomethoxy)phenyl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | N#CCOc1ccc(Br)cc1/C=N\NC(=O)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C18H10Br2IN3O3/c19-12-1-2-15(26-4-3-22)11(6-12)9-23-24-18(25)16-7-10-5-13(20)8-14(21)17(10)27-16/h1-2,5-9H,4H2,(H,24,25)/b23-9- |
| InChIKey | UUUMQKHGMDKGIR-AQHIEDMUSA-N |
| XLogP | 5.23 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|