C18H12BrIN2O5 — CID 126015288
2-[4-[(Z)-[(5-bromo-7-iodo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126015288) has the molecular formula C18H12BrIN2O5 and a molecular weight of 543.11 g/mol. Its IUPAC name is 2-[4-[(Z)-[(5-bromo-7-iodo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[(5-bromo-7-iodo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126015288 |
| Molecular Formula | C18H12BrIN2O5 |
| Molecular Weight | 543.11 g/mol |
| Exact Mass | 541.90 |
| IUPAC Name | 2-[4-[(Z)-[(5-bromo-7-iodo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N\NC(=O)c2cc3cc(Br)cc(I)c3o2)cc1 |
| InChI | InChI=1S/C18H12BrIN2O5/c19-12-5-11-6-15(27-17(11)14(20)7-12)18(25)22-21-8-10-1-3-13(4-2-10)26-9-16(23)24/h1-8H,9H2,(H,22,25)(H,23,24)/b21-8- |
| InChIKey | ACSISMGQIOEUTQ-WNFQYIGGSA-N |
| XLogP | 4.03 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.11 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|