C19H14BrIN4O3 — CID 126015939
5-bromo-N-[(Z)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126015939) has the molecular formula C19H14BrIN4O3 and a molecular weight of 553.15 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126015939 |
| Molecular Formula | C19H14BrIN4O3 |
| Molecular Weight | 553.15 g/mol |
| Exact Mass | 551.93 |
| IUPAC Name | 5-bromo-N-[(Z)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | Cn1c(=O)n(C)c2cc(/C=N\NC(=O)c3cc4cc(Br)cc(I)c4o3)ccc21 |
| InChI | InChI=1S/C19H14BrIN4O3/c1-24-14-4-3-10(5-15(14)25(2)19(24)27)9-22-23-18(26)16-7-11-6-12(20)8-13(21)17(11)28-16/h3-9H,1-2H3,(H,23,26)/b22-9- |
| InChIKey | DLYASFNTDXUXPB-AFPJDJCSSA-N |
| XLogP | 3.75 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|