C24H15BrIN3O2 — CID 21374400
5-bromo-7-iodo-N-[(E)-(1-naphthalen-2-ylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21374400) has the molecular formula C24H15BrIN3O2 and a molecular weight of 584.21 g/mol. Its IUPAC name is 5-bromo-7-iodo-N-[(E)-(1-naphthalen-2-ylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-7-iodo-N-[(E)-(1-naphthalen-2-ylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21374400 |
| Molecular Formula | C24H15BrIN3O2 |
| Molecular Weight | 584.21 g/mol |
| Exact Mass | 582.94 |
| IUPAC Name | 5-bromo-7-iodo-N-[(E)-(1-naphthalen-2-ylpyrrol-2-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1cccn1-c1ccc2ccccc2c1)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C24H15BrIN3O2/c25-18-10-17-12-22(31-23(17)21(26)13-18)24(30)28-27-14-20-6-3-9-29(20)19-8-7-15-4-1-2-5-16(15)11-19/h1-14H,(H,28,30)/b27-14+ |
| InChIKey | GVLQKAUETLYPOL-MZJWZYIUSA-N |
| XLogP | 6.51 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.21 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|