C21H19BrIN3O2 — CID 5227780
5-bromo-7-iodo-N-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 5227780) has the molecular formula C21H19BrIN3O2 and a molecular weight of 552.21 g/mol. Its IUPAC name is 5-bromo-7-iodo-N-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-7-iodo-N-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 5227780 |
| Molecular Formula | C21H19BrIN3O2 |
| Molecular Weight | 552.21 g/mol |
| Exact Mass | 550.97 |
| IUPAC Name | 5-bromo-7-iodo-N-[(2-methyl-4-pyrrolidin-1-ylphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(N2CCCC2)ccc1C=NNC(=O)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C21H19BrIN3O2/c1-13-8-17(26-6-2-3-7-26)5-4-14(13)12-24-25-21(27)19-10-15-9-16(22)11-18(23)20(15)28-19/h4-5,8-12H,2-3,6-7H2,1H3,(H,25,27) |
| InChIKey | RFWXLDUSLKWUOU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.21 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|