C23H16BrIN2O2S — CID 126249401
5-bromo-7-iodo-N-[(Z)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126249401) has the molecular formula C23H16BrIN2O2S and a molecular weight of 591.27 g/mol. Its IUPAC name is 5-bromo-7-iodo-N-[(Z)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-7-iodo-N-[(Z)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126249401 |
| Molecular Formula | C23H16BrIN2O2S |
| Molecular Weight | 591.27 g/mol |
| Exact Mass | 589.92 |
| IUPAC Name | 5-bromo-7-iodo-N-[(Z)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(Sc2ccc(/C=N\NC(=O)c3cc4cc(Br)cc(I)c4o3)cc2)cc1 |
| InChI | InChI=1S/C23H16BrIN2O2S/c1-14-2-6-18(7-3-14)30-19-8-4-15(5-9-19)13-26-27-23(28)21-11-16-10-17(24)12-20(25)22(16)29-21/h2-13H,1H3,(H,27,28)/b26-13- |
| InChIKey | QQKZRPBKXFPPGH-ZMFRSBBQSA-N |
| XLogP | 7.02 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.27 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|