C21H15BrIN3O3 — CID 50855509
5-bromo-7-iodo-N-[(Z)-[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 50855509) has the molecular formula C21H15BrIN3O3 and a molecular weight of 564.18 g/mol. Its IUPAC name is 5-bromo-7-iodo-N-[(Z)-[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-7-iodo-N-[(Z)-[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50855509 |
| Molecular Formula | C21H15BrIN3O3 |
| Molecular Weight | 564.18 g/mol |
| Exact Mass | 562.93 |
| IUPAC Name | 5-bromo-7-iodo-N-[(Z)-[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(-n2ccc(/C=N\NC(=O)c3cc4cc(Br)cc(I)c4o3)c2)cc1 |
| InChI | InChI=1S/C21H15BrIN3O3/c1-28-17-4-2-16(3-5-17)26-7-6-13(12-26)11-24-25-21(27)19-9-14-8-15(22)10-18(23)20(14)29-19/h2-12H,1H3,(H,25,27)/b24-11- |
| InChIKey | TTZJINSAPCNZJB-MYKKPKGFSA-N |
| XLogP | 5.36 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.18 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|