C20H13BrIN3O3 — CID 126022010
5-bromo-N-[(Z)-[1-(4-hydroxyphenyl)pyrrol-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126022010) has the molecular formula C20H13BrIN3O3 and a molecular weight of 550.15 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[1-(4-hydroxyphenyl)pyrrol-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-[1-(4-hydroxyphenyl)pyrrol-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126022010 |
| Molecular Formula | C20H13BrIN3O3 |
| Molecular Weight | 550.15 g/mol |
| Exact Mass | 548.92 |
| IUPAC Name | 5-bromo-N-[(Z)-[1-(4-hydroxyphenyl)pyrrol-2-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cccn1-c1ccc(O)cc1)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C20H13BrIN3O3/c21-13-8-12-9-18(28-19(12)17(22)10-13)20(27)24-23-11-15-2-1-7-25(15)14-3-5-16(26)6-4-14/h1-11,26H,(H,24,27)/b23-11- |
| InChIKey | ZSNLFLMCIARDDV-KSEXSDGBSA-N |
| XLogP | 5.06 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|