C32H20Br2IN3O2 — CID 126023406
5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 126023406) has the molecular formula C32H20Br2IN3O2 and a molecular weight of 765.24 g/mol. Its IUPAC name is 5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126023406 |
| Molecular Formula | C32H20Br2IN3O2 |
| Molecular Weight | 765.24 g/mol |
| Exact Mass | 762.90 |
| IUPAC Name | 5-bromo-N-[(E)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc(-c2ccccc2)n(-c2ccc(Br)cc2)c1-c1ccccc1)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C32H20Br2IN3O2/c33-24-11-13-26(14-12-24)38-28(20-7-3-1-4-8-20)16-23(30(38)21-9-5-2-6-10-21)19-36-37-32(39)29-17-22-15-25(34)18-27(35)31(22)40-29/h1-19H,(H,37,39)/b36-19+ |
| InChIKey | VXIQIRUWJQMSQD-ODNPBWNPSA-N |
| XLogP | 9.45 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.24 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|