C22H17Br2N3O3 — CID 21375995
5,7-dibromo-N-[(Z)-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375995) has the molecular formula C22H17Br2N3O3 and a molecular weight of 531.20 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375995 |
| Molecular Formula | C22H17Br2N3O3 |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)c(C)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C22H17Br2N3O3/c1-12-7-15(13(2)27(12)17-3-5-18(28)6-4-17)11-25-26-22(29)20-9-14-8-16(23)10-19(24)21(14)30-20/h3-11,28H,1-2H3,(H,26,29)/b25-11- |
| InChIKey | AWQAASSCHJBQEG-GATIEOLUSA-N |
| XLogP | 5.83 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|