C29H22Br2FN3O3 — CID 21376009
5,7-dibromo-N-[(Z)-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376009) has the molecular formula C29H22Br2FN3O3 and a molecular weight of 639.32 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376009 |
| Molecular Formula | C29H22Br2FN3O3 |
| Molecular Weight | 639.32 g/mol |
| Exact Mass | 637.00 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)c(C)n1-c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H22Br2FN3O3/c1-17-11-21(15-33-34-29(36)27-13-20-12-22(30)14-26(31)28(20)38-27)18(2)35(17)24-7-9-25(10-8-24)37-16-19-3-5-23(32)6-4-19/h3-15H,16H2,1-2H3,(H,34,36)/b33-15- |
| InChIKey | JWQJHTRCPHRSEV-UHIZKJEFSA-N |
| XLogP | 7.85 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.32 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|