C26H20FN3O2 — CID 6876408
N-[(E)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 6876408) has the molecular formula C26H20FN3O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-[(E)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 6876408 |
| Molecular Formula | C26H20FN3O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[(E)-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2cc3c(ccc4ccccc43)o2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20FN3O2/c1-16-13-19(17(2)30(16)21-10-8-20(27)9-11-21)15-28-29-26(31)25-14-23-22-6-4-3-5-18(22)7-12-24(23)32-25/h3-15H,1-2H3,(H,29,31)/b28-15+ |
| InChIKey | TYGMUTDPHMJSRQ-RWPZCVJISA-N |
| XLogP | 5.90 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|