C22H16Br2ClN3O2 — CID 21375548
5,7-dibromo-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375548) has the molecular formula C22H16Br2ClN3O2 and a molecular weight of 549.65 g/mol. Its IUPAC name is 5,7-dibromo-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375548 |
| Molecular Formula | C22H16Br2ClN3O2 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 546.93 |
| IUPAC Name | 5,7-dibromo-N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2cc3cc(Br)cc(Br)c3o2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16Br2ClN3O2/c1-12-7-15(13(2)28(12)18-5-3-17(25)4-6-18)11-26-27-22(29)20-9-14-8-16(23)10-19(24)21(14)30-20/h3-11H,1-2H3,(H,27,29)/b26-11+ |
| InChIKey | IGQQGKNFWMZVBV-KBKYJPHKSA-N |
| XLogP | 6.78 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|