C28H25F2N3O2 — CID 126253066
2-(4-fluorophenyl)-N-[(E)-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126253066) has the molecular formula C28H25F2N3O2 and a molecular weight of 473.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(E)-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(E)-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126253066 |
| Molecular Formula | C28H25F2N3O2 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(E)-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N/NC(=O)Cc2ccc(F)cc2)c(C)n1-c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C28H25F2N3O2/c1-19-15-23(17-31-32-28(34)16-21-7-9-24(29)10-8-21)20(2)33(19)25-11-13-26(14-12-25)35-18-22-5-3-4-6-27(22)30/h3-15,17H,16,18H2,1-2H3,(H,32,34)/b31-17+ |
| InChIKey | KQPDGLWIEFRPEI-KBVAKVRCSA-N |
| XLogP | 5.64 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|