C16H8Br2IN3O5 — CID 137173040
5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide (PubChem CID 137173040) has the molecular formula C16H8Br2IN3O5 and a molecular weight of 608.97 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 137173040 |
| Molecular Formula | C16H8Br2IN3O5 |
| Molecular Weight | 608.97 g/mol |
| Exact Mass | 606.79 |
| IUPAC Name | 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-7-iodo-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)cc([N+](=O)[O-])c1O)c1cc2cc(Br)cc(I)c2o1 |
| InChI | InChI=1S/C16H8Br2IN3O5/c17-9-1-7-3-13(27-15(7)11(19)4-9)16(24)21-20-6-8-2-10(18)5-12(14(8)23)22(25)26/h1-6,23H,(H,21,24)/b20-6- |
| InChIKey | MEJPELLWEMHHFW-IOXNKQMXSA-N |
| XLogP | 4.94 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|