C8H7BrN4O3S — CID 4300530
[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]thiourea (PubChem CID 4300530) has the molecular formula C8H7BrN4O3S and a molecular weight of 319.14 g/mol. Its IUPAC name is [(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]thiourea.
| Compound Name | [(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4300530 |
| Molecular Formula | C8H7BrN4O3S |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | [(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H7BrN4O3S/c9-5-1-4(3-11-12-8(10)17)7(14)6(2-5)13(15)16/h1-3,14H,(H3,10,12,17) |
| InChIKey | SCEPZNMDYSCHJG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|